Melting point |
>300°C |
Boiling point |
422.66°C (rough estimate) |
Density |
1.1633 (estimate) |
refractive index |
1.8430 (estimate) |
storage temp. |
Sealed in dry,Room Temperature |
form |
powder to crystal |
color |
Light yellow to Yellow to Green |
InChI |
InChI=1S/C28H18/c1-5-13-23-19(9-1)17-20-10-2-6-14-24(20)27(23)28-25-15-7-3-11-21(25)18-22-12-4-8-16-26(22)28/h1-18H |
InChIKey |
SXGIRTCIFPJUEQ-UHFFFAOYSA-N |
SMILES |
C1=C2C(C=C3C(=C2C2C4=CC=CC=C4C=C4C=2C=CC=C4)C=CC=C3)=CC=C1 |
CAS DataBase Reference |
1055-23-8(CAS DataBase Reference) |
EWG's Food Scores |
1 |
NIST Chemistry Reference |
9,9'-Bianthracene(1055-23-8) |
EPA Substance Registry System |
9,9'-Bianthracene (1055-23-8) |