Di-tert-butylchlorosilane
- Product NameDi-tert-butylchlorosilane
- CAS56310-18-0
- CBNumberCB1456686
- MFC8H19ClSi
- MW178.77
- MDL NumberMFCD00010755
- MOL File56310-18-0.mol
- MSDS FileSDS
Chemical Properties
| Boiling point | 82-84 °C/45 mmHg (lit.) |
| Density | 0.884 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 103 °F |
| form | Liquid |
| color | Clear colorless |
| Specific Gravity | 0.884 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2203045 |
| Stability | Stable. Flammable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H19ClSi/c1-7(2,3)10(9)8(4,5)6/h10H,1-6H3 |
| InChIKey | OGWXFZNXPZTBST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[SiH](Cl)C(C)(C)C |
| CAS DataBase Reference | 56310-18-0 |
| UNSPSC Code | 12352001 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
| Signal word | Danger |
| Hazard statements | H226-H314 |
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | 10-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2986 8/PG 2 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 8 |
| PackingGroup | II |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |
