3,3'-Dimethoxybenzidine dihydrochloride
- Product Name3,3'-Dimethoxybenzidine dihydrochloride
- CAS20325-40-0
- CBNumberCB1410086
- MFC14H17ClN2O2
- MW280.75
- EINECS243-737-5
- MDL NumberMFCD00012488
- MOL File20325-40-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 268 °C |
| Flash point | 206℃ |
| storage temp. | 2-8°C |
| solubility | H2O: soluble25mg/mL |
| form | tablet |
| color | Light beige to purple-gray |
| PH | 1.7 at 20℃ and 100g/L |
| Water Solubility | 1-5 g/100 mL at 20 ºC |
| BRN | 3917996 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C14H16N2O2.ClH/c1-17-13-7-9(3-5-11(13)15)10-4-6-12(16)14(8-10)18-2;/h3-8H,15-16H2,1-2H3;1H |
| InChIKey | UXTIAFYTYOEQHV-UHFFFAOYSA-N |
| SMILES | O(C1=C(C=CC(C2C=CC(N)=C(OC)C=2)=C1)N)C.Cl |
| Toxicology and Carcinogenesis | Toxicology and Carcinogenesis Studies of 3,3'-Dimethoxybenzidine Dihydrochloride (CASRN 20325-40-0) in F344/N Rats (Drinking Water Studies) |
| CAS DataBase Reference | 20325-40-0(CAS DataBase Reference) |
| FDA UNII | QV96QA6UKK |
| Proposition 65 List | 3,3'-Dimethoxybenzidine dihydrochloride |
| EPA Substance Registry System | 3,3'-Dimethoxybenzidine dihydrochloride (20325-40-0) |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H350 | |||||||||
| Precautionary statements | P202-P264-P270-P280-P301+P312-P308+P313 | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 45-22 | |||||||||
| Safety Statements | 53-45 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DD1050000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29222990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Carc. 1B Eye Dam. 1 Skin Corr. 1 | |||||||||
| NFPA 704: |
|
