3-Cyano-7-hydroxycoumarin
- Product Name3-Cyano-7-hydroxycoumarin
- CAS19088-73-4
- CBNumberCB1344231
- MFC10H5NO3
- MW187.15
- EINECS200-123-4
- MDL NumberMFCD00037480
- MOL File19088-73-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | ≥250 °C(lit.) |
| Boiling point | 436.6±45.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 7.03 ± 0.20, most acidic, temperature: 25 °C |
| color | Yellow solid or powder |
| λmax | 408 nm (Buffer pH 9); 408 nm (MeOH) |
| BRN | 153271 |
| Major Application | Electroluminescentdevice;laser dyes; modified polyester for foodcontainers/beverage bottles; monitoring of cationicphotopolymerization processes;textiles;thin films |
| Biological Applications | Detectingmicroorganisms,nucleic acids; inhibiting cellproliferation/tumor growth; reference standard foresters; ethers,phosphates substrates; asa substrate for measuring nucleic acid polymerasesactivity; treating viral or parasite infections |
| InChI | 1S/C10H5NO3/c11-5-7-3-6-1-2-8(12)4-9(6)14-10(7)13/h1-4,12H |
| InChIKey | IJQYTHQDUDCJEQ-UHFFFAOYSA-N |
| SMILES | Oc1ccc2C=C(C#N)C(=O)Oc2c1 |
| CAS DataBase Reference | 19088-73-4 |
| UNSPSC Code | 12352108 |
| NACRES | NA.32 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8 | |||||||||
| HS Code | 2932.20.4500 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|