2,7-Diaminofluorene
- Product Name2,7-Diaminofluorene
- CAS525-64-4
- CBNumberCB1276109
- MFC13H12N2
- MW196.25
- EINECS208-377-5
- MDL NumberMFCD00001128
- MOL File525-64-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 160-162 °C (lit.) |
| Boiling point | 323.14°C (rough estimate) |
| Density | 1.1265 (rough estimate) |
| refractive index | 1.5014 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystaline |
| pka | 4.63±0.20(Predicted) |
| color | White to Gray to Brown |
| Water Solubility | Slightly soluble in cold water. Soluble in hot water. Sparingly soluble in ethanol. and acetone. Insoluble in ether. |
| Merck | 14,4156 |
| BRN | 2099859 |
| InChI | InChI=1S/C13H12N2/c14-10-1-3-12-8(6-10)5-9-7-11(15)2-4-13(9)12/h1-4,6-7H,5,14-15H2 |
| InChIKey | SNCJAJRILVFXAE-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC(N)=C2)C2=C1C=C(N)C=C2 |
| CAS DataBase Reference | 525-64-4(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | U63328L315 |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | LL6980000 | |||||||||
| HS Code | 2921.51.5000 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
