| Melting point |
65-67℃ |
| Boiling point |
425.8±38.0 °C(Predicted) |
| Density |
1.304 |
| storage temp. |
-20°C |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form |
powder to crystal |
| pka |
3.04±0.20(Predicted) |
| color |
White to Almost white |
| optical activity |
[α]22/D 35.0, c = 1 in chloroform |
| Sensitive |
Moisture Sensitive |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C10H15NO5/c1-10(2,3)16-9(15)11-6(8(13)14)4-5-7(11)12/h6H,4-5H2,1-3H3,(H,13,14)/t6-/m0/s1 |
| InChIKey |
MJLQPFJGZTYCMH-LURJTMIESA-N |
| SMILES |
N1(C(OC(C)(C)C)=O)C(=O)CC[C@H]1C(O)=O |
| CAS DataBase Reference |
53100-44-0 |
| EPA Substance Registry System |
1,2-Pyrrolidinedicarboxylic acid, 5-oxo-, 1-(1,1-dimethylethyl) ester, (2S)- (53100-44-0) |
| UNSPSC Code |
12352106 |
| NACRES |
NA.22 |