9-Vinylcarbazole
- Product Name9-Vinylcarbazole
- CAS1484-13-5
- CBNumberCB1104635
- MFC14H11N
- MW193.24
- EINECS216-055-0
- MDL NumberMFCD00004966
- MOL File1484-13-5.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 60-65 °C(lit.) |
| Boiling point | 154-155 °C3 mm Hg(lit.) |
| Density | 1,085 g/cm3 |
| refractive index | 1.5850 (estimate) |
| Flash point | 182℃ |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Soluble in acetonitrile. |
| form | Crystalline Powder |
| color | Off-white to yellow |
| BRN | 132988 |
| Stability | Stable. Incompatible with strong acids, strong oxidizing agents. |
| InChI | InChI=1S/C14H11N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h2-10H,1H2 |
| InChIKey | KKFHAJHLJHVUDM-UHFFFAOYSA-N |
| SMILES | N1(C=C)C2=C(C=CC=C2)C2=C1C=CC=C2 |
| CAS DataBase Reference | 1484-13-5(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | D629AMY6F9 |
| EPA Substance Registry System | 9-Vinylcarbazole (1484-13-5) |
Safety
| Symbol(GHS) |
![]() ![]()
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300-H312-H315-H317-H341-H410 | |||||||||
| Precautionary statements | P202-P261-P273-P280-P301+P310-P302+P352+P312 | |||||||||
| Hazard Codes | Xn,N | |||||||||
| Risk Statements | 21/22-38-43-50/53-68 | |||||||||
| Safety Statements | 22-23-36/37-60-61 | |||||||||
| RIDADR | UN 2811 6.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | FE6350000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29339900 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Muta. 2 Skin Irrit. 2 Skin Sens. 1 | |||||||||
| NFPA 704: |
|



