7-Hydroxy-4-(trifluoromethyl)coumarin
- Product Name7-Hydroxy-4-(trifluoromethyl)coumarin
- CAS575-03-1
- CBNumberCB1102257
- MFC10H5F3O3
- MW230.14
- EINECS124-586-5
- MDL NumberMFCD00037578
- MOL File575-03-1.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 178-180 °C (lit.) |
| Boiling point | 311.4±42.0 °C(Predicted) |
| Density | 1.4435 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 7.23±0.20(Predicted) |
| color | White to Light yellow to Light orange |
| λmax | 330nm(Toluene)(lit.) |
| BRN | 210932 |
| InChI | InChI=1S/C10H5F3O3/c11-10(12,13)7-4-9(15)16-8-3-5(14)1-2-6(7)8/h1-4,14H |
| InChIKey | CCKWMCUOHJAVOL-UHFFFAOYSA-N |
| SMILES | C1(=O)OC2=CC(O)=CC=C2C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 575-03-1(CAS DataBase Reference) |
| UNSPSC Code | 12352103 |
| NACRES | NA.23 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300-H315-H319-H335 | |||||||||
| Precautionary statements | P301+P310+P330-P302+P352-P305+P351+P338 | |||||||||
| Hazard Codes | Xi,T | |||||||||
| Risk Statements | 36/37/38-25 | |||||||||
| Safety Statements | 26-36-45 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 8-10 | |||||||||
| HazardClass | IRRITANT | |||||||||
| HS Code | 29322090 | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
