3,5-Difluorophenol
- Product Name3,5-Difluorophenol
- CAS2713-34-0
- CBNumberCB0288255
- MFC6H4F2O
- MW130.09
- EINECS608-047-4
- MDL NumberMFCD00002255
- MOL File2713-34-0.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 54-57 °C (lit.) |
| Boiling point | 65-68°C 1mm |
| Density | 1.2483 (estimate) |
| Flash point | 159 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | ethanol: soluble50, clear, colorless to faint yellow or tan (mg/mL) |
| pka | 7.97±0.10(Predicted) |
| form | Crystals |
| color | White to beige |
| BRN | 2078616 |
| InChI | InChI=1S/C6H4F2O/c7-4-1-5(8)3-6(9)2-4/h1-3,9H |
| InChIKey | HJSSBIMVTMYKPD-UHFFFAOYSA-N |
| SMILES | C1(O)=CC(F)=CC(F)=C1 |
| CAS DataBase Reference | 2713-34-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Difluorophenol(2713-34-0) |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| Hazard Codes | Xn,Xi,C,F | |||||||||
| Risk Statements | 20/21/22-36/37/38-34-11 | |||||||||
| Safety Statements | 26-36-45-36/37/39-16 | |||||||||
| RIDADR | UN 1325 4.1/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Harmful | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29081000 | |||||||||
| Storage Class | 4.1B - Flammable solid hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 | |||||||||
| NFPA 704: |
|
