N-(Tris(hydroxymethyl)methyl)-2-aminoethanesulfonic acid sodium salt
- Product NameN-(Tris(hydroxymethyl)methyl)-2-aminoethanesulfonic acid sodium salt
- CAS70331-82-7
- CBNumberCB0274850
- MFC6H16NNaO6S
- MW253.24
- EINECS642-884-6
- MDL NumberMFCD03066123
- MOL File70331-82-7.mol
- MSDS FileSDS
Chemical Properties
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: 0.35 g/mL, clear, colorless |
| form | Powder |
| color | White to Almost white |
| pka | 7.5(at 25℃) |
| PH Range | 6.8 - 8.2 |
| PH | 6.8-8.2 |
| Water Solubility | Soluble in water (350 g/L) at 20°C, and methanol(very faint turbidity). |
| InChI | 1S/C6H15NO6S.Na/c8-3-6(4-9,5-10)7-1-2-14(11,12)13;/h7-10H,1-5H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey | GUXMFAHOYNRHBI-UHFFFAOYSA-M |
| SMILES | [Na+].OCC(CO)(CO)NCCS([O-])(=O)=O |
| CAS DataBase Reference | 70331-82-7(CAS DataBase Reference) |
| EPA Substance Registry System | Ethanesulfonic acid, 2-[[2-hydroxy-1,1-bis(hydroxymethyl)ethyl]amino]-, monosodium salt (70331-82-7) |
| UNSPSC Code | 12161700 |
| NACRES | NA.25 |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-24/25 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29221990 |
| Storage Class | 11 - Combustible Solids |
