Thiacloprid
- Product NameThiacloprid
- CAS111988-49-9
- CBNumberCB0260844
- MFC10H9ClN4S
- MW252.72
- EINECS601-147-9
- MDL NumberMFCD02101042
- MOL File111988-49-9.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 128-129° |
| Boiling point | 423.1±55.0 °C(Predicted) |
| Density | 1.42±0.1 g/cm3(Predicted) |
| vapor pressure | 0-0Pa at 20-25℃ |
| storage temp. | -20°C |
| solubility | Chloroform: Slightly Soluble,Methanol: Slightly Soluble |
| form | Solid |
| pka | 0.01±0.10(Predicted) |
| color | White to off-white |
| Henry's Law Constant | 9.0×108 mol/(m3Pa) at 25℃, HSDB (2015) |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C10H9ClN4S/c11-9-2-1-8(5-13-9)6-15-3-4-16-10(15)14-7-12/h1-2,5H,3-4,6H2/b14-10+ |
| InChIKey | HOKKPVIRMVDYPB-GXDHUFHOSA-N |
| SMILES | N1(CCS/C/1=N/C#N)CC1=CN=C(Cl)C=C1 |
| LogP | 1.3-1.4 at 24℃ and pH4-9 |
| Surface tension | 72mN/m at 150mg/L and 20℃ |
| CAS DataBase Reference | 111988-49-9(CAS DataBase Reference) |
| FDA UNII | DSV3A944A4 |
Safety
| Symbol(GHS) |
  
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H332-H336-H351-H360FD-H410 | |||||||||
| Precautionary statements | P201-P273-P301+P310+P330-P304+P340+P312 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/22-52/53 | |||||||||
| Safety Statements | 60 | |||||||||
| RIDADR | 2588 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | GS6093749 | |||||||||
| HazardClass | 6.1(b) | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29349990 | |||||||||
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | |||||||||
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Inhalation Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Repr. 1B STOT SE 3 | |||||||||
| Hazardous Substances Data | 111988-49-9(Hazardous Substances Data) | |||||||||
| Toxicity | LD50 in male, female rats (mg/kg): 836, 444 orally; >2000, >2000 dermally; LC50 (4 hr) in male, female rats (mg/m3): >2535, 1223; LC50 (96 hr) in rainbow trout (mg/l): 30.5 (Elbert) | |||||||||
| NFPA 704: |
|
