Benzydamine hydrochloride
- Product NameBenzydamine hydrochloride
- CAS132-69-4
- CBNumberCB0204309
- MFC19H23N3O.ClH
- MW345.87
- EINECS205-076-0
- MDL NumberMFCD00078957
- MOL File132-69-4.mol
Chemical Properties
| Melting point | 147-153°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | Soluble in water, ethanol, chloroform, n-butanol or DMSO /n |
| Merck | 14,1122 |
| Major Application | forensics and toxicology pharmaceutical (small molecule) veterinary |
| InChI | InChI=1S/C19H23N3O.ClH/c1-21(2)13-8-14-23-19-17-11-6-7-12-18(17)22(20-19)15-16-9-4-3-5-10-16;/h3-7,9-12H,8,13-15H2,1-2H3;1H |
| InChIKey | HNNIWKQLJSNAEQ-UHFFFAOYSA-N |
| SMILES | C12C=CC=CC=1C(=NN2CC1C=CC=CC=1)OCCCN(C)C.Cl |
| CAS DataBase Reference | 132-69-4(CAS DataBase Reference) |
| EWG's Food Scores | 1 |
| FDA UNII | K2GI407R4Q |
| NCI Drug Dictionary | benzydamine hydrochloride |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H319 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P305+P351+P338-P337+P313 | |||||||||
| Hazard Codes | Xn | |||||||||
| Risk Statements | 20/21/22-36 | |||||||||
| Safety Statements | 26-36 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | NK7875000 | |||||||||
| HS Code | 2933.99.8290 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 | |||||||||
| Toxicity | LD50 in mice, rats (mg/kg): 110, 100 i.p.; 515, 1050 orally (Silvestrini) | |||||||||
| NFPA 704: |
|