| Melting point |
150-152°C |
| Boiling point |
418.94℃ |
| Density |
0.737g/cm3 at 21℃ |
| vapor pressure |
0Pa at 25℃ |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| form |
Solid |
| color |
Light yellow to Yellow to Orange |
| InChI |
InChI=1S/C6H6N2O5S.Na/c7-5-2-1-4(8(9)10)3-6(5)14(11,12)13;/h1-3H,7H2,(H,11,12,13);/q;+1/p-1 |
| InChIKey |
VTMRGLXTSDVXAE-UHFFFAOYSA-M |
| SMILES |
C1(S([O-])(=O)=O)=C(N)C=CC([N+]([O-])=O)=C1.[Na+] |
| Dissociation constant |
0 at 21℃ |
| CAS DataBase Reference |
30693-53-9(CAS DataBase Reference) |
| EPA Substance Registry System |
Benzenesulfonic acid, 2-amino-5-nitro-, monosodium salt (30693-53-9) |
