| Appearance |
yellow-brown solid |
| Melting point |
68-69 °C(lit.) |
| Boiling point |
196 °C11 mm Hg(lit.) |
| density |
1.8836 (rough estimate) |
| vapor density |
7.6 (vs air)
|
| refractive index |
1.6290 (estimate) |
| Fp |
196°C/12mm |
| storage temp. |
2-8°C
|
| solubility |
Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form |
Crystals or Crystalline Needles |
| color |
Yellow to beige |
| Stability: |
Stable. Incompatible with strong oxidizing agents, water, moisture, nitrates, combustible material. Refrigerate. |
| Water Solubility |
Slightly soluble in water. |
| Sensitive |
Moisture Sensitive |
| Merck |
14,3277 |
| BRN |
990249 |
| InChI |
1S/C7H3ClN2O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H |
| InChIKey |
NNOHXABAQAGKRZ-UHFFFAOYSA-N |
| SMILES |
[O-][N+](=O)c1cc(cc(c1)[N+]([O-])=O)C(Cl)=O |
| CAS DataBase Reference |
99-33-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
Benzoyl chloride, 3,5-dinitro-(99-33-2) |
| EPA Substance Registry System |
99-33-2(EPA Substance) |
