98057-08-0
| Name | 5,5''-dibromo-[2,2':5',2"]terthiohene |
| CAS | 98057-08-0 |
| Molecular Formula | C12H6Br2S3 |
| MDL Number | MFCD00219109 |
| Molecular Weight | 406.185 |
| MOL File | 98057-08-0.mol |
Chemical Properties
| Melting point | 150-155 °C |
| Boiling point | 417.2±40.0 °C(Predicted) |
| density | 1.839 |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| InChI | InChI=1S/C12H6Br2S3/c13-11-5-3-9(16-11)7-1-2-8(15-7)10-4-6-12(14)17-10/h1-6H |
| InChIKey | KXFPYYJGYVYXIB-UHFFFAOYSA-N |
| SMILES | C1(C2SC(C3SC(Br)=CC=3)=CC=2)SC(Br)=CC=1 |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |