97-35-8
| Name | Fast Red ITR |
| CAS | 97-35-8 |
| EINECS(EC#) | 202-575-5 |
| Molecular Formula | C11H18N2O3S |
| MDL Number | MFCD00009045 |
| Molecular Weight | 258.34 |
| MOL File | 97-35-8.mol |
Chemical Properties
| Melting point | 102-105°C |
| Boiling point | 410.6±55.0 °C(Predicted) |
| density | 1.205±0.06 g/cm3(Predicted) |
| storage temp. | room temp |
| solubility | chloroform: methanol (1:1): 1% |
| Colour Index | 37150 |
| form | powder to crystal |
| pka | 3.23±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| λmax | 226 nm |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C11H18N2O3S/c1-4-13(5-2)17(14,15)9-6-7-11(16-3)10(12)8-9/h6-8H,4-5,12H2,1-3H3 |
| InChIKey | WBGVVXSCGNGJFL-UHFFFAOYSA-N |
| SMILES | C1(S(N(CC)CC)(=O)=O)=CC=C(OC)C(N)=C1 |
| CAS DataBase Reference | 97-35-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Methoxyaniline-5-sulfonic acid diethylamide(97-35-8) |
| EPA Substance Registry System | 97-35-8(EPA Substance) |