95910-36-4
| Name | (-)-ISOLEDENE |
| CAS | 95910-36-4 |
| Molecular Formula | C15H24 |
| MDL Number | MFCD00043330 |
| Molecular Weight | 204.35 |
| MOL File | 95910-36-4.mol |
Chemical Properties
| Boiling point | 95 °C/5 mmHg (lit.) |
| density | 0.902 g/mL at 20 °C (lit.) |
| refractive index | n |
| storage temp. | 2-8°C |
| form | neat |
| Optical Rotation | [α]20/D 50.5±1°, neat |
| BRN | 2085196 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | 1S/C15H24/c1-9-6-8-12-14(15(12,3)4)13-10(2)5-7-11(9)13/h9-10,12,14H,5-8H2,1-4H3/t9-,10-,12-,14-/m1/s1 |
| InChIKey | NUQDPKOFUKFKFD-BGOOENEXSA-N |
| SMILES | C[C@@H]1CC[C@@H]2[C@H](C3=C1CC[C@H]3C)C2(C)C |
| LogP | 6.385 (est) |