
939-83-3
| Name | 2-METHYL-5-NITROBENZONITRILE |
| CAS | 939-83-3 |
| Molecular Formula | C8H6N2O2 |
| MDL Number | MFCD00017040 |
| Molecular Weight | 162.15 |
| MOL File | 939-83-3.mol |
Chemical Properties
| Melting point | 103.5-107.5 °C (lit.) |
| Boiling point | 175°C/10mmHg(lit.) |
| density | 1.3264 (rough estimate) |
| refractive index | 1.5770 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | ethanol: soluble(lit.) |
| form | powder to crystal |
| color | White to Light yellow |
| BRN | 1947376 |
| InChI | 1S/C8H6N2O2/c1-6-2-3-8(10(11)12)4-7(6)5-9/h2-4H,1H3 |
| InChIKey | XOSDYLFXPMFRGF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(cc1C#N)[N+]([O-])=O |
| CAS DataBase Reference | 939-83-3(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
