
939-80-0
| Name | 4-CHLORO-3-NITROBENZONITRILE |
| CAS | 939-80-0 |
| EINECS(EC#) | 213-364-2 |
| Molecular Formula | C7H3ClN2O2 |
| MDL Number | MFCD00016987 |
| Molecular Weight | 182.56 |
| MOL File | 939-80-0.mol |
Chemical Properties
| Appearance | light yellow crystalline powder |
| Melting point | 98-100 °C (lit.) |
| Boiling point | 284.8±25.0 °C(Predicted) |
| density | 1.6133 (rough estimate) |
| refractive index | 1.5557 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Slightly soluble in water |
| form | powder to crystal |
| color | White to Light yellow to Green |
| BRN | 1639111 |
| InChI | InChI=1S/C7H3ClN2O2/c8-6-2-1-5(4-9)3-7(6)10(11)12/h1-3H |
| InChIKey | XBLPHYSLHRGMNW-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Cl)C([N+]([O-])=O)=C1 |
| CAS DataBase Reference | 939-80-0(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 2 |
| RTECS | DI3050000 |
| REACH Registrations | Active |
| HS Code | 29269090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
