
937174-76-0
| Name | 4-[2-(4-Amino-1,2,5-oxadiazol-3-yl)-1-ethyl-7-[(3S)-3-piperidinylmethoxy]-1H-imidazo[4,5-c]pyridin-4-yl]-2-methyl-3-butyn-2-ol |
| CAS | 937174-76-0 |
| Molecular Formula | C21H27N7O3 |
| MDL Number | MFCD14105605 |
| Molecular Weight | 425.48 |
| MOL File | 937174-76-0.mol |
Chemical Properties
| Boiling point | 683.8±65.0 °C(Predicted) |
| density | 1.41 |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble5mg/mL (clear solution) |
| form | powder |
| pka | 13.11±0.29(Predicted) |
| color | white to beige |
| Stability: | Stable for 2 years from date of purchase as supplied. Solutions in DMSO or distilled water may be stored at -20° for up to 1 month. |
| InChIKey | KGPGFQWBCSZGEL-ZDUSSCGKSA-N |
| SMILES | CC(C)(O)C#CC1=NC=C(OC[C@H]2CCCNC2)C2N(CC)C(C3C(N)=NON=3)=NC1=2 |
Safety Data
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | 3 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |