927-49-1
| Name | 6-Undecanone |
| CAS | 927-49-1 |
| EINECS(EC#) | 213-150-9 |
| Molecular Formula | C11H22O |
| MDL Number | MFCD00009516 |
| Molecular Weight | 170.29 |
| MOL File | 927-49-1.mol |
Chemical Properties
| Appearance | clear colorless to slightly yellow liquid |
| Melting point | 14.6 °C(lit.) |
| Boiling point | 228 °C(lit.) |
| density | 0.831 g/mL at 25 °C(lit.) |
| FEMA | 4022 |
| refractive index | n |
| Fp | 191 °F |
| storage temp. | Store at room temperature |
| form | neat |
| color | Colorless to Light yellow to Light orange |
| Odor | char. odor |
| Thermal Conductivity | 0.132 W/(m·K) at 25 ℃ |
| JECFA Number | 1155 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| InChI | InChI=1S/C11H22O/c1-3-5-7-9-11(12)10-8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | ZPQAKYPOZRXKFA-UHFFFAOYSA-N |
| SMILES | CCCCCC(=O)CCCCC |
| LogP | 4.09 |
| CAS DataBase Reference | 927-49-1(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Safety Statements | |
| RIDADR | UN 1993 / PGIII |
| WGK Germany | 3 |
| RTECS | YQ2828000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29141990 |
| Storage Class | 10 - Combustible liquids |
| Safety Profile |