91978-69-7
| Name | PotassiuM p-Tolyl Sulfate |
| CAS | 91978-69-7 |
| Molecular Formula | C7H7KO4S |
| MDL Number | MFCD28100835 |
| Molecular Weight | 226.291 |
| MOL File | 91978-69-7.mol |
Chemical Properties
| Melting point | 189-193°C |
| storage temp. | Hygroscopic, Refrigerator, Under inert atmosphere |
| solubility | DMSO (Slightly), Water (Slightly) |
| form | Solid |
| color | White to Pale Yelllow |
| biological source | synthetic |
| Stability: | Hygroscopic |
| InChI | 1S/C7H8O4S.K/c1-6-2-4-7(5-3-6)11-12(8,9)10;/h2-5H,1H3,(H,8,9,10); |
| InChIKey | PQVKZHHETGONTQ-UHFFFAOYSA-N |
| SMILES | O=S(O)(OC1=CC=C(C)C=C1)=O.[K] |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | WGK 3 |
| HS Code | 2904.10.3700 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Chronic 2 Eye Dam. 1 Skin Corr. 1B |