918-21-8
| Name | HEXAFLUORO-2,3-BIS(TRIFLUOROMETHYL)BUTANE-2,3-DIOL |
| CAS | 918-21-8 |
| Molecular Formula | C6H2F12O2 |
| MDL Number | MFCD00427700 |
| Molecular Weight | 334.06 |
| MOL File | 918-21-8.mol |
Chemical Properties
| Melting point | 18 °C |
| Boiling point | 129 °C |
| density | 1.870 g/mL at 25 °C |
| refractive index | 1.3102 |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump to clear liquid |
| pka | 7.56±0.29(Predicted) |
| color | White or Colorless to Almost white or Almost colorless |
| InChI | 1S/C6H2F12O2/c7-3(8,9)1(19,4(10,11)12)2(20,5(13,14)15)6(16,17)18/h19-20H |
| InChIKey | GKDCWKGUOZVDFX-UHFFFAOYSA-N |
| SMILES | OC(C(F)(F)F)(C(F)(F)F)C(O)(C(F)(F)F)C(F)(F)F |
| CAS DataBase Reference | 918-21-8(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluoropinacol (918-21-8) |
Safety Data
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 6.1 / PGI |
| WGK Germany | 3 |
| RTECS | EK0650000 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT |
| HS Code | 29055900 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |