
91-13-4
| Name | 1,2-Bis(bromomethyl)benzene |
| CAS | 91-13-4 |
| EINECS(EC#) | 202-042-7 |
| Molecular Formula | C8H8Br2 |
| MDL Number | MFCD00000175 |
| Molecular Weight | 263.96 |
| MOL File | 91-13-4.mol |
Chemical Properties
| Appearance | white to light yellow crystal powde |
| Melting point | 91-94 °C(lit.) |
| Boiling point | 140 °C / 20mmHg |
| density | 1.96 g/mL at 25 °C(lit.) |
| refractive index | 1.6113 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | sol ethanol, ether, chloroform; slightly sol petroleum ether. |
| form | Crystals or Crystalline Powder |
| color | White to light cream |
| Water Solubility | soluble, hydrolyses |
| Detection Methods | GC,NMR |
| BRN | 637159 |
| InChI | InChI=1S/C8H8Br2/c9-5-7-3-1-2-4-8(7)6-10/h1-4H,5-6H2 |
| InChIKey | KGKAYWMGPDWLQZ-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC=CC=C1CBr |
| CAS DataBase Reference | 91-13-4(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1,2-bis(bromomethyl)-(91-13-4) |
| Storage Precautions | Moisture sensitive;Light sensitive |
| EPA Substance Registry System | 91-13-4(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P302+P352-P305+P351+P338 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3448 6.1/PG 2 |
| WGK Germany | 2 |
| F | 8-19-21 |
| TSCA | Yes |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29036990 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
