89-60-1
| Name | 4-Chloro-3-nitrotoluene |
| CAS | 89-60-1 |
| EINECS(EC#) | 201-922-8 |
| Molecular Formula | C7H6ClNO2 |
| MDL Number | MFCD00007085 |
| Molecular Weight | 171.58 |
| MOL File | 89-60-1.mol |
Chemical Properties
| Appearance | CLEAR YELLOW LIQUID |
| Melting point | 7 °C(lit.) |
| Boiling point | 260 °C745 mm Hg(lit.) |
| density | 1.297 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Light yellow to Yellow to Orange |
| BRN | 511055 |
| InChI | 1S/C7H6ClNO2/c1-5-2-3-6(8)7(4-5)9(10)11/h2-4H,1H3 |
| InChIKey | NWESJZZPAJGHRZ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 89-60-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-methyl-2-nitro-(89-60-1) |
| EPA Substance Registry System | 89-60-1(EPA Substance) |
Safety Data
| Hazard Codes | Xn,N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2433 6.1/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
