
88495-63-0
| Name | Artesunate |
| CAS | 88495-63-0 |
| EINECS(EC#) | 618-170-5 |
| Molecular Formula | C19H28O8 |
| MDL Number | MFCD00866204 |
| Molecular Weight | 384.42 |
| MOL File | 88495-63-0.mol |
Chemical Properties
| Appearance | Fine-White Crystalline Powder |
| Melting point | 132-1350C |
| Boiling point | 431.1°C (rough estimate) |
| density | 1.2076 (rough estimate) |
| refractive index | 1.4430 (estimate) |
| Fp | 173.5° |
| storage temp. | Room temp |
| solubility | acetone: soluble33.4mg/mL |
| form | crystalline powder |
| pka | 4.28±0.17(Predicted) |
| color | white to off-white |
| biological source | Artemisia annua |
| Merck | 14,818 |
| BCS Class | 3/1 |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20°C for up to 1 month. |
| Major Application | pharmaceutical small molecule |
| InChIKey | FIHJKUPKCHIPAT-AHIGJZGOSA-N |
| SMILES | C(O[C@@H]1O[C@]2([H])O[C@@]3(C)CC[C@@]4([H])[C@H](C)CC[C@@]([H])([C@H]1C)[C@]42OO3)(=O)CCC(O)=O |
| LogP | 3.291 (est) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302+H312+H332 |
| Precautionary statements | P261-P264-P280-P301+P312-P302+P352+P312-P304+P340+P312 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29419090 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
| Hazardous Substances Data | 88495-63-0(Hazardous Substances Data) |

