
88122-99-0
| Name | Ethylhexyl Triazone |
| CAS | 88122-99-0 |
| EINECS(EC#) | 402-070-1 |
| Molecular Formula | C48H66N6O6 |
| MDL Number | MFCD09753106 |
| Molecular Weight | 823.07 |
| MOL File | 88122-99-0.mol |
Chemical Properties
| Melting point | 128° |
| Boiling point | 869.5±75.0 °C(Predicted) |
| density | 1.129±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 20℃ |
| Fp | 307℃ |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO : 30 mg/mL (36.45 mM) |
| form | neat |
| pka | 1.22±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | 5-7μg/L at 25℃ |
| λmax | 314nm(lit.) |
| Merck | 14,3809 |
| BRN | 11001015 |
| Major Application | cleaning products cosmetics environmental food and beverages personal care |
| Cosmetics Ingredients Functions | UV ABSORBER LIGHT STABILIZER UV FILTER |
| InChIKey | JGUMTYWKIBJSTN-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)c1ccc(Nc2nc(Nc3ccc(cc3)C(=O)OCC(CC)CCCC)nc(Nc4ccc(cc4)C(=O)OCC(CC)CCCC)n2)cc1 |
| LogP | 7 at 25℃ |
