
86864-60-0
| Name | (2-BROMOETHOXY)-TERT-BUTYLDIMETHYLSILANE |
| CAS | 86864-60-0 |
| Molecular Formula | C8H19BrOSi |
| MDL Number | MFCD00209550 |
| Molecular Weight | 239.23 |
| MOL File | 86864-60-0.mol |
Chemical Properties
| Boiling point | 70-75 °C2.5 mm Hg(lit.) |
| density | 1.115 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 163 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| color | White to pale yellow |
| Specific Gravity | 1.115 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| InChI | InChI=1S/C8H19BrOSi/c1-8(2,3)11(4,5)10-7-6-9/h6-7H2,1-5H3 |
| InChIKey | JBKINHFZTVLNEM-UHFFFAOYSA-N |
| SMILES | [Si](OCCBr)(C(C)(C)C)(C)C |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
