855-38-9
| Name | TRIS(4-METHOXYPHENYL)PHOSPHINE |
| CAS | 855-38-9 |
| EINECS(EC#) | 212-723-0 |
| Molecular Formula | C21H21O3P |
| MDL Number | MFCD00014896 |
| Molecular Weight | 352.36 |
| MOL File | 855-38-9.mol |
Chemical Properties
| Appearance | White to pale yellow crystalline powder |
| Melting point | 131-134 °C (lit.) |
| Boiling point | 457.8±40.0 °C(Predicted) |
| density | 1.1352 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Crystalline Powder |
| color | White to pale yellow |
| Water Solubility | Insoluble in water. |
| Sensitive | Air Sensitive |
| BRN | 2815911 |
| InChI | InChI=1S/C21H21O3P/c1-22-16-4-10-19(11-5-16)25(20-12-6-17(23-2)7-13-20)21-14-8-18(24-3)9-15-21/h4-15H,1-3H3 |
| InChIKey | UYUUAUOYLFIRJG-UHFFFAOYSA-N |
| SMILES | P(C1=CC=C(OC)C=C1)(C1=CC=C(OC)C=C1)C1=CC=C(OC)C=C1 |
| CAS DataBase Reference | 855-38-9(CAS DataBase Reference) |
| EPA Substance Registry System | Phosphine, tris(4-methoxyphenyl)- (855-38-9) |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29319090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |