850583-75-4
| Name | 3,6-Di(2-thienyl)-2,5-dihydropyrrolo[3,4-c]pyrrole-1,4-dione |
| CAS | 850583-75-4 |
| Molecular Formula | C14H8N2O2S2 |
| MDL Number | MFCD20257907 |
| Molecular Weight | 300.356 |
| MOL File | 850583-75-4.mol |
Chemical Properties
| Boiling point | 691.9±55.0 °C(Predicted) |
| density | 1.60±0.1 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 8.13±0.60(Predicted) |
| color | Dark green to Dark red to Black |
| InChI | InChI=1S/C14H8N2O2S2/c17-13-9-10(12(16-13)8-4-2-6-20-8)14(18)15-11(9)7-3-1-5-19-7/h1-6H,(H,15,18)(H,16,17) |
| InChIKey | YIUHGBNJJRTMIE-UHFFFAOYSA-N |
| SMILES | N1C(C2SC=CC=2)=C2C(=O)NC(C3SC=CC=3)=C2C1=O |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |