84-02-6
| Name | PROCHLORPERAZINE MALEATE |
| CAS | 84-02-6 |
| EINECS(EC#) | 201-511-3 |
| Molecular Formula | C28H32ClN3O8S |
| MDL Number | MFCD00069330 |
| Molecular Weight | 606.09 |
| MOL File | 84-02-6.mol |
Chemical Properties
| Appearance | Off-White Powder |
| Melting point | 1750C |
| storage temp. | Store at RT |
| solubility | Very slightly soluble in water and in ethanol (96 per cent). |
| form | neat |
| pka | pKa 8.1(H2O,t =24±1) (Uncertain) |
| color | White |
| Water Solubility | H2O: slightly soluble 0.3mg/mL 45% (w/v) aq 2-hydroxypropyl-β-cyclodextrin: 2.3mg/mL methanol: soluble |
| λmax | 313nm(MeOH)(lit.) |
| Merck | 14,7761 |
| Stability: | Stable for 2 years as supplied. Solutions in DMSO may be stored at -20° for up to 3 months. |
| Major Application | pharmaceutical |
| InChIKey | DSKIOWHQLUWFLG-SPIKMXEPSA-N |
| SMILES | OC(=O)\C=C/C(O)=O.OC(=O)\C=C/C(O)=O.CN1CCN(CCCN2c3ccccc3Sc4ccc(Cl)cc24)CC1 |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | SO3150000 |
| HS Code | 2934302300 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Lact. Repr. 2 STOT SE 3 |
| Toxicity |