
83915-83-7
| Name | Lisinopril |
| CAS | 83915-83-7 |
| EINECS(EC#) | 627-033-9 |
| Molecular Formula | C21H31N3O5 |
| MDL Number | MFCD08064198 |
| Molecular Weight | 405.49 |
| MOL File | 83915-83-7.mol |
Chemical Properties
| Appearance | White to Off-White Crystalline Powder |
| Melting point | 148 °C |
| alpha | 25405 -120° (c = 1 in 0.25M pH 6.4 zinc acetate); 25436 -96° (c = 1 in 0.25M pH 6.4 zinc acetate) |
| refractive index | -45 ° (C=1, 0.25mol/L Zinc Acetate Buffer) |
| storage temp. | 2-8°C |
| solubility | H2O: ≥10 mg/mL |
| form | solid |
| pka | 2.5, 4.0, 6.7, 10.1(at 25℃) |
| color | white |
| Water Solubility | H2O: ≥10mg/mL DMSO: ~6.5mg/mL (with heating and sonicating) |
| Usage | An orally active angiotensin-converting enzyme (ACE) inhibitor. S,S,S-Isomer of Lisinopril |
| Merck | 5516 |
| Stability: | Hygroscopic |
| InChIKey | BAVDEDVBIHTHJQ-CFCOLZOMNA-N |
| SMILES | C(N1CCC[C@H]1C(=O)O)(=O)[C@H](CCCCN)N[C@H](C(=O)O)CCC1C=CC=CC=1.O |&1:5,10,17,r| |
| CAS DataBase Reference | 83915-83-7(CAS DataBase Reference) |
| EPA Substance Registry System | L-Proline, N2-[(1S)-1-carboxy-3-phenylpropyl]-L-lysyl-, hydrate (1:2) (83915-83-7) |
Safety Data
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360D-H373 |
| Precautionary statements | P202-P260-P280-P308+P313-P405-P501 |
| Hazard Codes | Xi,Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | TW3589990 |
| HazardClass | IRRITANT |
| HS Code | 2933995300 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1A STOT RE 2 |
| Hazardous Substances Data | 83915-83-7(Hazardous Substances Data) |
