
83048-65-1
| Name | (HEPTADECAFLUORO-1,1,2,2-TETRAHYDRODECYL)TRIMETHOXYSILANE |
| CAS | 83048-65-1 |
| EINECS(EC#) | 617-434-7 |
| Molecular Formula | C13H13F17O3Si |
| MDL Number | MFCD07368748 |
| Molecular Weight | 568.3 |
| MOL File | 83048-65-1.mol |
Chemical Properties
| Melting point | -31 °C |
| Boiling point | 247°C |
| density | 1,54 g/cm3 |
| refractive index | 1.33125 |
| Fp | >65°C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.54 |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| Cosmetics Ingredients Functions | BULKING |
| InChI | InChI=1S/C13H13F17O3Si/c1-31-34(32-2,33-3)5-4-6(14,15)7(16,17)8(18,19)9(20,21)10(22,23)11(24,25)12(26,27)13(28,29)30/h4-5H2,1-3H3 |
| InChIKey | HJIMAFKWSKZMBK-UHFFFAOYSA-N |
| SMILES | [Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OC)(OC)OC |
| LogP | 7.280 (est) |
| EPA Substance Registry System | Silane, (3,3,4,4,5,5,6,6,7,7,8,8,9, 9,10,10,10-heptadecafluorodecyl) trimethoxy-(83048-65-1) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P201-P202-P263-P301+P312-P304+P340+P312-P308+P313 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3265 8 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | No |
| HS Code | 29420000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |

