
826-62-0
| Name | Himic anhydride |
| CAS | 826-62-0 |
| EINECS(EC#) | 204-957-7 |
| Molecular Formula | C9H8O3 |
| MDL Number | MFCD00151106 |
| Molecular Weight | 164.16 |
| MOL File | 826-62-0.mol |
Chemical Properties
| Melting point | 165-167 °C(lit.) |
| Boiling point | 251.61°C (rough estimate) |
| density | 1.2132 (rough estimate) |
| refractive index | 1.5260 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | diethyl ether: soluble0.1g/10 mL, clear, colorless |
| form | powder to crystal |
| color | White to Almost white |
| Specific Gravity | 1.250 (20/4℃) |
| Merck | 14,1796 |
| BRN | 150228 |
| InChI | InChI=1S/C9H8O3/c10-8-6-4-1-2-5(3-4)7(6)9(11)12-8/h1-2,4-7H,3H2 |
| InChIKey | KNDQHSIWLOJIGP-UHFFFAOYSA-N |
| SMILES | C1(=O)C2C(C3CC2C=C3)C(=O)O1 |
| LogP | -0.040 (est) |
| CAS DataBase Reference | 826-62-0(CAS DataBase Reference) |
| EPA Substance Registry System | 826-62-0(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H318-H334 |
| Precautionary statements | P261-P280-P305+P351+P338-P342+P311 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1325 |
| WGK Germany | 3 |
| RTECS | DT5600000 |
| F | 21 |
| TSCA | TSCA listed |
| REACH Registrations | Active |
| HS Code | 38220090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Dam. 1 Resp. Sens. 1 Skin Sens. 1 |
| Toxicity |

