
82-45-1
| Name | 1-Amino anthraquinone |
| CAS | 82-45-1 |
| EINECS(EC#) | 201-423-5 |
| Molecular Formula | C14H9NO2 |
| MDL Number | MFCD00001213 |
| Molecular Weight | 223.23 |
| MOL File | 82-45-1.mol |
Chemical Properties
| Appearance | deep brown crystalline powder |
| Melting point | 253-255 °C (lit.) |
| Boiling point | 364.52°C (rough estimate) |
| density | 1.1814 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | room temp |
| solubility | Soluble in alcohol, benzene, chlroform, ether, glacial acetic acid, HCl |
| Colour Index | 37275 |
| form | powder to crystal |
| pka | -0.51±0.20(Predicted) |
| color | Orange to Brown to Dark red |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. |
| Water Solubility | 312.5ug/L(25 ºC) |
| Merck | 14,417 |
| BRN | 396360 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C14H9NO2/c15-11-7-3-6-10-12(11)14(17)9-5-2-1-4-8(9)13(10)16/h1-7H,15H2 |
| InChIKey | KHUFHLFHOQVFGB-UHFFFAOYSA-N |
| SMILES | Nc1cccc2C(=O)c3ccccc3C(=O)c12 |
Safety Data
| Symbol(GHS) | ![]() ![]() ![]() GHS08,GHS09,GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335-H320-H373-H410 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a-P260-P264-P273-P305+P351+P338+P337+P313-P314-P391-P501 |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3077 |
| WGK Germany | 1 |
| RTECS | CB5075000 |
| TSCA | Yes |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29223900 |
| Storage Class | 11 - Combustible Solids |
| Safety Profile |


