
81927-55-1
| Name | BENZYL 2,2,2-TRICHLOROACETIMIDATE |
| CAS | 81927-55-1 |
| Molecular Formula | C9H8Cl3NO |
| MDL Number | MFCD00000805 |
| Molecular Weight | 252.52 |
| MOL File | 81927-55-1.mol |
Chemical Properties
| Appearance | clear colorless to yellow liquid |
| Melting point | 3 °C |
| Boiling point | 106-114 °C0.5 mm Hg(lit.) |
| density | 1.359 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | Miscible with cyclohexane/dichloromethane. |
| form | Liquid |
| pka | 2.23±0.70(Predicted) |
| color | Clear colorless to yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2525375 |
| Stability: | Moisture Sensitive |
| InChI | InChI=1S/C9H8Cl3NO/c10-9(11,12)8(13)14-6-7-4-2-1-3-5-7/h1-5,13H,6H2 |
| InChIKey | HUZCTWYDQIQZPM-UHFFFAOYSA-N |
| SMILES | C(=N)(OCC1=CC=CC=C1)C(Cl)(Cl)Cl |
| CAS DataBase Reference | 81927-55-1(CAS DataBase Reference) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| F | 8-10-21 |
| HS Code | 29252900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
