
813-93-4
| Name | Bismuth citrate |
| CAS | 813-93-4 |
| EINECS(EC#) | 212-390-1 |
| Molecular Formula | C6H5BiO7 |
| MDL Number | MFCD00050817 |
| Molecular Weight | 398.08 |
| MOL File | 813-93-4.mol |
Chemical Properties
| Appearance | White Crystalline Powder |
| Melting point | 300 °C (dec.) (lit.) |
| density | 0.94 g/mL at 25 °C(lit.) |
| vapor pressure | 0Pa at 20℃ |
| storage temp. | -20°C Freezer |
| solubility | Water (Very Slightly) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Insoluble in water, alcohol, ether. Soluble in ammonia solution and in solution of alkali citrates. Typical tap density 0.50g/cm^3.Soluble in ammonia, alkali citrates. Insoluble in water, alcohol and ether. |
| Sensitive | Light Sensitive |
| Cosmetics Ingredients Functions | BUFFERING CHELATING HAIR DYEING |
| InChI | InChI=1S/C6H8O7.Bi.3H/c7-3(8)1-6(13,5(11)12)2-4(9)10;;;;/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;;; |
| InChIKey | FNVSCXCYBVACNW-UHFFFAOYSA-N |
| SMILES | C(O)(C(=O)O)(CC(=O)O)CC(=O)O.[BiH3] |
| LogP | -0.37 at 25℃ |
| CAS DataBase Reference | 813-93-4(CAS DataBase Reference) |
| EPA Substance Registry System | 813-93-4(EPA Substance) |