
81-08-3
| Name | 2-Sulfobenzoic anhydride |
| CAS | 81-08-3 |
| EINECS(EC#) | 201-322-6 |
| Molecular Formula | C7H4O4S |
| MDL Number | MFCD00005879 |
| Molecular Weight | 184.17 |
| MOL File | 81-08-3.mol |
Chemical Properties
| Appearance | White to beige crystals or crystalline powder |
| Melting point | 116-124 °C |
| Boiling point | 184-186 °C18 mm Hg(lit.) |
| density | 1.6114 (rough estimate) |
| refractive index | 1.6290 (estimate) |
| Fp | 184-186°C/18mm |
| storage temp. | Store below +30°C. |
| solubility | soluble in Toluene |
| form | Crystals or Crystalline Powder |
| color | White to beige |
| Sensitive | Moisture Sensitive |
| BRN | 139893 |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | InChI=1S/C7H4O4S/c8-7-5-3-1-2-4-6(5)12(9,10)11-7/h1-4H |
| InChIKey | NCYNKWQXFADUOZ-UHFFFAOYSA-N |
| SMILES | S1(=O)(=O)C2=CC=CC=C2C(=O)O1 |
| Uses | |
| CAS DataBase Reference | 81-08-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Sulfobenzoic acid cyclic anhydride(81-08-3) |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2923 |
| WGK Germany | 3 |
| F | 21 |
| TSCA | Yes |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
