
80370-57-6
| Name | Ceftiofur |
| CAS | 80370-57-6 |
| EINECS(EC#) | 1308068-626-2 |
| Molecular Formula | C19H17N5O7S3 |
| MDL Number | MFCD04038020 |
| Molecular Weight | 523.57 |
| MOL File | 80370-57-6.mol |
Chemical Properties
| Appearance | Powder. |
| Melting point | >212°C (dec.) |
| density | 1.81±0.1 g/cm3(Predicted) |
| storage temp. | 0-6°C |
| solubility | DMSO (Slightly), Methanol (Very Slightly, Heated, Sonicated) |
| form | neat |
| pka | 2.62±0.50(Predicted) |
| color | Off-White to Pale Beige |
| Stability: | Hygroscopic |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChIKey | ZBHXIWJRIFEVQY-IHMPYVIRSA-N |
| SMILES | N12[C@@]([H])([C@H](NC(/C(/C3=CSC(N)=N3)=N\OC)=O)C1=O)SCC(CSC(C1=CC=CO1)=O)=C2C(O)=O |
Safety Data
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H317-H334 |
| Precautionary statements | P261-P272-P280-P284-P302+P352-P333+P313 |
| Safety Statements | |
| WGK Germany | 2 |
| HS Code | 29349990 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| Safety Profile | |
| Hazardous Substances Data | 80370-57-6(Hazardous Substances Data) |
