
8013-90-9
| Name | Ionone |
| CAS | 8013-90-9 |
| EINECS(EC#) | 232-396-8 |
| Molecular Formula | C13H20O |
| MDL Number | MFCD00167092 |
| Molecular Weight | 192.3 |
| MOL File | 8013-90-9.mol |
Chemical Properties
| Appearance | Light-yellow to colorless liquid; violet odor.Soluble in alcohol, ether, mineral oil, and propylene glycol; insoluble in water and glycerol. |
| Boiling point | 288.3°C (rough estimate) |
| density | 0.9275 (rough estimate) |
| vapor pressure | 0.0013 hPa ( 20 °C) |
| FEMA | 2595 |
| refractive index | 1.5200 (estimate) |
| storage temp. | Store below +30°C. |
| form | liquid |
| Odor | at 10.00 % in dipropylene glycol. violet sweet floral woody |
| Odor Type | floral |
| Cosmetics Ingredients Functions | FRAGRANCE ASTRINGENT PERFUMING |
| InChI | 1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h6-8,12H,5,9H2,1-4H3/b8-7+ |
| InChIKey | UZFLPKAIBPNNCA-BQYQJAHWSA-N |
| SMILES | O=C(C)\C=C\C1C(CCC=C1C)(C)C |
| LogP | 4.100 |
| Uses | |
| CAS DataBase Reference | 8013-90-9(CAS DataBase Reference) |
| NIST Chemistry Reference | Ionone(8013-90-9) |
| EPA Substance Registry System | 8013-90-9(EPA Substance) |