
79983-71-4
| Name | Hexaconazole |
| CAS | 79983-71-4 |
| EINECS(EC#) | 413-050-7 |
| Molecular Formula | C14H17Cl2N3O |
| MDL Number | MFCD00144441 |
| Molecular Weight | 314.21 |
| MOL File | 79983-71-4.mol |
Chemical Properties
| Melting point | 111°C |
| Boiling point | 490.3±55.0 °C(Predicted) |
| density | d25 1.29 |
| vapor pressure | 1.8 x l0-6 Pa (20 °C) |
| refractive index | 1.5490 (estimate) |
| storage temp. | 0-6°C |
| solubility | DMSO: Soluble; Methanol: Soluble |
| form | neat |
| pka | 12.26±0.29(Predicted) |
| Water Solubility | 17 mg l-1(20 °C) |
| color | White to off-white |
| Merck | 13,4700 |
| BRN | 8328399 |
| Henry's Law Constant | 2.8×101 mol/(m3Pa) at 25℃, Barcelo and Hennion (1997) |
| Major Application | agriculture environmental |
| InChI | 1S/C14H17Cl2N3O/c1-2-3-6-14(20,8-19-10-17-9-18-19)12-5-4-11(15)7-13(12)16/h4-5,7,9-10,20H,2-3,6,8H2,1H3 |
| InChIKey | STMIIPIFODONDC-UHFFFAOYSA-N |
| SMILES | CCCCC(O)(Cn1cncn1)c2ccc(Cl)cc2Cl |
| NIST Chemistry Reference | 1H-1,2,4-triazole-1-ethanol, «alpha»-butyl-«alpha»-(2,4-dichlorophenyl)-, (.+/-.)-(79983-71-4) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302-H317-H411 |
| Precautionary statements | P261-P264-P273-P280-P301+P312-P302+P352 |
| Hazard Codes | Xn;N,N,Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN3077 9/PG 3 |
| WGK Germany | 2 |
| RTECS | XZ4803200 |
| REACH Registrations | Inactive |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 2 Skin Sens. 1 |
| Toxicity |

