
7703-74-4
| Name | 2,6-BIS(BROMOMETHYL)PYRIDINE |
| CAS | 7703-74-4 |
| Molecular Formula | C7H7Br2N |
| MDL Number | MFCD00191795 |
| Molecular Weight | 264.95 |
| MOL File | 7703-74-4.mol |
Chemical Properties
| Melting point | 85-87 °C(lit.) |
| Boiling point | 275.6±30.0 °C(Predicted) |
| density | 1.870±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | powder to crystaline |
| pka | 1.65±0.24(Predicted) |
| color | White to Almost white |
| InChI | InChI=1S/C7H7Br2N/c8-4-6-2-1-3-7(5-9)10-6/h1-3H,4-5H2 |
| InChIKey | QUTSYCOAZVHGGT-UHFFFAOYSA-N |
| SMILES | C1(CBr)=NC(CBr)=CC=C1 |
Safety Data
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3335 |
| WGK Germany | 3 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
