7693-41-6
| Name | 4-METHOXYPHENYL CHLOROFORMATE |
| CAS | 7693-41-6 |
| EINECS(EC#) | 200-110-4 |
| Molecular Formula | C8H7ClO3 |
| MDL Number | MFCD00013258 |
| Molecular Weight | 186.59 |
| MOL File | 7693-41-6.mol |
Chemical Properties
| Appearance | clear colorless to pale yellow liquid |
| Boiling point | 49 °C0.27 mm Hg(lit.) |
| density | 1.255 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 0-6°C |
| form | Liquid |
| color | Clear colorless to pale yellow |
| InChI | InChI=1S/C8H7ClO3/c1-11-6-2-4-7(5-3-6)12-8(9)10/h2-5H,1H3 |
| InChIKey | CCFSGQKTSBIIHG-UHFFFAOYSA-N |
| SMILES | C(Cl)(OC1=CC=C(OC)C=C1)=O |
| EPA Substance Registry System | Carbonochloridic acid, 4-methoxyphenyl ester (7693-41-6) |
Safety Data
| Hazard Codes | T,C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3277 6.1/PG 2 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29159000 |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Corr. 1B |