76-93-7
| Name | Benzilic acid |
| CAS | 76-93-7 |
| EINECS(EC#) | 200-993-2 |
| Molecular Formula | C14H12O3 |
| MDL Number | MFCD00004447 |
| Molecular Weight | 228.24 |
| MOL File | 76-93-7.mol |
Chemical Properties
| Appearance | white powder |
| Melting point | 149-151 °C(lit.) |
| Boiling point | 180 °C |
| density | 1.28 |
| refractive index | 1.5805 (estimate) |
| Fp | 180°C/22mm |
| storage temp. | Store below +30°C. |
| solubility | 1.41g/l (experimental) |
| form | Powder |
| pka | pKa (25°): 3.036 |
| color | White to cream-white |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Water Solubility | 1.41 g/L (25 ºC) |
| Merck | 14,1080 |
| BRN | 521402 |
| Cosmetics Ingredients Functions | BUFFERING |
| InChI | 1S/C14H12O3/c15-13(16)14(17,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,17H,(H,15,16) |
| InChIKey | UKXSKSHDVLQNKG-UHFFFAOYSA-N |
| SMILES | OC(c2ccccc2)(c1ccccc1)C(=O)O |
Safety Data
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280f-P403+P233-P405 |
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| RTECS | DD2064000 |
| Autoignition Temperature | 530°C |
| TSCA | Yes |
| REACH Registrations | Active |
| HS Code | 29181980 |
| Storage Class | 11 - Combustible Solids |
| Hazardous Substances Data | 76-93-7(Hazardous Substances Data) |
| Toxicity |