73365-02-3
| Name | N-(TERT-BUTOXYCARBONYL)-D-PROLINAL |
| CAS | 73365-02-3 |
| EINECS(EC#) | 624-637-4 |
| Molecular Formula | C10H17NO3 |
| MDL Number | MFCD01321389 |
| Molecular Weight | 199.25 |
| MOL File | 73365-02-3.mol |
Chemical Properties
| Appearance | Clear colorless to yellow liquid |
| alpha | +83°(23℃, neat) |
| Boiling point | 228 °C(lit.) |
| density | 1.059 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Freezer (-20°C) |
| form | Liquid |
| pka | -3.03±0.40(Predicted) |
| color | Colorless to yellow |
| Specific Gravity | 1.059 |
| Optical Rotation | [α]23/D +83°, neat |
| Sensitive | Air Sensitive |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C10H17NO3/c1-10(2,3)14-9(13)11-6-4-5-8(11)7-12/h7-8H,4-6H2,1-3H3/t8-/m1/s1 |
| InChIKey | YDBPZCVWPFMBDH-MRVPVSSYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCC[C@@H]1C=O |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| WGK Germany | 3 |
| HS Code | 29339980 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
