
7252-83-7
| Name | Bromoacetaldehyde dimethyl acetal |
| CAS | 7252-83-7 |
| EINECS(EC#) | 230-669-6 |
| Molecular Formula | C4H9BrO2 |
| MDL Number | MFCD00000213 |
| Molecular Weight | 169.02 |
| MOL File | 7252-83-7.mol |
Chemical Properties
| Appearance | clear colourless to light yellow liquid |
| Boiling point | 148-150 °C (lit.) |
| density | 1.43 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 129 °F |
| storage temp. | Refrigerator (+4°C) + Flammables area |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| Specific Gravity | 1.445 |
| Water Solubility | insoluble |
| Sensitive | Moisture Sensitive |
| Detection Methods | GC |
| BRN | 1280132 |
| InChI | InChI=1S/C4H9BrO2/c1-6-4(3-5)7-2/h4H,3H2,1-2H3 |
| InChIKey | FUSFWUFSEJXMRQ-UHFFFAOYSA-N |
| SMILES | C(OC)(OC)CBr |
| CAS DataBase Reference | 7252-83-7(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethane, 2-bromo-1,1-dimethoxy-(7252-83-7) |
| EPA Substance Registry System | 7252-83-7(EPA Substance) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1989 3/PG 3 |
| WGK Germany | 3 |
| F | 8-9-21 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29110000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 |

