72509-76-3
| Name | Felodipine |
| CAS | 72509-76-3 |
| EINECS(EC#) | 620-472-7 |
| Molecular Formula | C18H19Cl2NO4 |
| MDL Number | MFCD08235033 |
| Molecular Weight | 384.25 |
| MOL File | 72509-76-3.mol |
Chemical Properties
| Appearance | White or Light Yellow Crystalline Powder |
| Melting point | 142-145°C |
| Boiling point | 471.5±45.0 °C(Predicted) |
| density | 1.3506 (rough estimate) |
| refractive index | 1.6500 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: 28 mg/mL |
| form | solid |
| pka | 2.73±0.70(Predicted) |
| color | light yellow |
| Water Solubility | insoluble |
| Usage | A dihydropyridine calcium channel blocker |
| Stability: | Stable for 1 year from date of purchase as supplied. Solutions in DMSO or ethanol may be stored at -20° for up to 3 months. |
| Major Application | pharmaceutical pharmaceutical small molecule |
| InChI | InChI=1S/C18H19Cl2NO4/c1-5-25-18(23)14-10(3)21-9(2)13(17(22)24-4)15(14)11-7-6-8-12(19)16(11)20/h6-8,15,21H,5H2,1-4H3 |
| InChIKey | RZTAMFZIAATZDJ-UHFFFAOYSA-N |
| SMILES | C1(C)NC(C)=C(C(OC)=O)C(C2=CC=CC(Cl)=C2Cl)C=1C(OCC)=O |
| CAS DataBase Reference | 72509-76-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Felodipine(72509-76-3) |
Safety Data
| Hazard Codes | Xn |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | 3 |
| RTECS | US7968700 |
| HS Code | 29333990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral Aquatic Acute 1 Aquatic Chronic 1 Repr. 2 STOT RE 2 Inhalation |