
70-34-8
| Name | 2,4-Dinitrofluorobenzene |
| CAS | 70-34-8 |
| EINECS(EC#) | 200-734-3 |
| Molecular Formula | C6H3FN2O4 |
| MDL Number | MFCD00007056 |
| Molecular Weight | 186.1 |
| MOL File | 70-34-8.mol |
Chemical Properties
| Appearance | Yellow solid |
| Melting point | 25-27 °C(lit.) |
| Boiling point | 178 °C25 mm Hg(lit.) |
| density | 1.482 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | 2-8°C |
| solubility | chloroform: 0.1 g/mL, clear |
| form | Liquid or Low Melting Crystals |
| color | Yellow to brownish |
| Specific Gravity | 1.482 |
| Stability: | Stable. Combustible. Incompatible with strong oxidizing agents, strong bases. |
| Water Solubility | 400 mg/L (25 ºC) |
| Merck | 14,4172 |
| BRN | 398632 |
| InChI | 1S/C6H3FN2O4/c7-5-2-1-4(8(10)11)3-6(5)9(12)13/h1-3H |
| Contact allergens | |
| InChIKey | LOTKRQAVGJMPNV-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc(F)c(c1)[N+]([O-])=O |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Warning |
| Hazard statements | H302-H315-H317-H319-H335-H373 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338-P314 |
| Hazard Codes | C,T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| RTECS | CZ7800000 |
| Hazard Note | Toxic |
| TSCA | Yes |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29049085 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT RE 2 STOT SE 3 |
| Safety Profile | |
| Hazardous Substances Data | 70-34-8(Hazardous Substances Data) |

