699-98-9
| Name | 2,3-Pyridinedicarboxylic anhydride |
| CAS | 699-98-9 |
| EINECS(EC#) | 211-834-1 |
| Molecular Formula | C7H3NO3 |
| MDL Number | MFCD00005915 |
| Molecular Weight | 149.1 |
| MOL File | 699-98-9.mol |
Chemical Properties
| Appearance | white crystal powde |
| Melting point | 137-139 °C (lit.) |
| Boiling point | 270.14°C (rough estimate) |
| density | 1.4974 (rough estimate) |
| refractive index | 1.4835 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -2.24±0.20(Predicted) |
| color | White to Orange to Green |
| Water Solubility | Optimal solubility in water. |
| Sensitive | Moisture Sensitive |
| Detection Methods | HPLC,NMR |
| BRN | 125111 |
| InChI | InChI=1S/C7H3NO3/c9-6-4-2-1-3-8-5(4)7(10)11-6/h1-3H |
| InChIKey | MCQOWYALZVKMAR-UHFFFAOYSA-N |
| SMILES | C12C(=O)OC(=O)C1=CC=CN=2 |
| CAS DataBase Reference | 699-98-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3-Pyridinedicarboxylic anhydride(699-98-9) |
| Storage Precautions | Moisture sensitive |