
698-00-0
| Name | 2-BROMO-N,N-DIMETHYLANILINE |
| CAS | 698-00-0 |
| EINECS(EC#) | 615-013-2 |
| Molecular Formula | C8H10BrN |
| MDL Number | MFCD00013522 |
| Molecular Weight | 200.08 |
| MOL File | 698-00-0.mol |
Chemical Properties
| Boiling point | 108°C 14mm |
| density | 1.388 |
| refractive index | 1.5745 |
| Fp | 108°C/14mm |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | clear liquid |
| pka | 4.40±0.18(Predicted) |
| color | Colorless to Light orange to Yellow |
| BRN | 2205741 |
| InChI | InChI=1S/C8H10BrN/c1-10(2)8-6-4-3-5-7(8)9/h3-6H,1-2H3 |
| InChIKey | ONMSBNJJCUCYED-UHFFFAOYSA-N |
| SMILES | C1(N(C)C)=CC=CC=C1Br |
| CAS DataBase Reference | 698-00-0(CAS DataBase Reference) |
Safety Data
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 2810 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | Ⅲ |
| HS Code | 29214990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 Eye Irrit. 2 STOT RE 2 |